Tergitol® 15-S-5, Surfactant
Tergitol® 15-S-5 is a specialized nonionic surfactant classified as a Secondary Alcohol Ethoxylate. Renowned for its exceptional emulsification and detergency capabilities, this product significantly enhances the efficiency of paint thickeners while improving the rinse-ability of solvent-based systems. Tergitol® 15-S-5 is highly recommended for use in a variety of applications, including:
Key Features and Specifications
| Chemical Characteristics |
Surfactant |
| Chemical CAS Number |
84133-50-6 |
| Chemical Formula |
C11-15H23-31O(CH2CCH2O)xH |
| Chemical Formula Weight |
Approx. F.W. 420 |
| pH (1% in 10:6 Isopropanol/Water Solution) |
6.0-8.0 |
| Maximum Limits |
Color (APHA): 75
Water: 0.5%
|
| Chemical UPS Limit |
150 lb |
| Health Rating |
2 |
| Flammability Rating |
1 |
| Chemical Category |
Surfactants | Detergent |
Why Choose Tergitol® 15-S-5?
This surfactant excels in delivering high-performance cleaning solutions, making it an essential component in formulations that require effective emulsification, sudsing, and soil removal capabilities. Optimize your cleaning and coating processes with Tergitol® 15-S-5 to achieve superior results.
